C18H19F2N7O3 — CID 175966216
4-[3-[1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyanilino]-N-ethoxypyridazine-3-carboxamide (PubChem CID 175966216) has the molecular formula C18H19F2N7O3 and a molecular weight of 419.39 g/mol. Its IUPAC name is 4-[3-[1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyanilino]-N-ethoxypyridazine-3-carboxamide.
| Compound Name | 4-[3-[1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyanilino]-N-ethoxypyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175966216 |
| Molecular Formula | C18H19F2N7O3 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[3-[1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-2-methoxyanilino]-N-ethoxypyridazine-3-carboxamide |
| SMILES | CCONC(=O)c1nnccc1Nc1cccc(-c2ncn(CC(F)F)n2)c1OC |
| InChI | InChI=1S/C18H19F2N7O3/c1-3-30-26-18(28)15-12(7-8-22-24-15)23-13-6-4-5-11(16(13)29-2)17-21-10-27(25-17)9-14(19)20/h4-8,10,14H,3,9H2,1-2H3,(H,22,23)(H,26,28) |
| InChIKey | YMSNPEYOQGEVIO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|