C19H19FN6O3 — CID 175427899
N-ethoxy-4-[5-fluoro-2-methoxy-3-(5-methylpyrimidin-2-yl)anilino]pyridazine-3-carboxamide (PubChem CID 175427899) has the molecular formula C19H19FN6O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is N-ethoxy-4-[5-fluoro-2-methoxy-3-(5-methylpyrimidin-2-yl)anilino]pyridazine-3-carboxamide.
| Compound Name | N-ethoxy-4-[5-fluoro-2-methoxy-3-(5-methylpyrimidin-2-yl)anilino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175427899 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-ethoxy-4-[5-fluoro-2-methoxy-3-(5-methylpyrimidin-2-yl)anilino]pyridazine-3-carboxamide |
| SMILES | CCONC(=O)c1nnccc1Nc1cc(F)cc(-c2ncc(C)cn2)c1OC |
| InChI | InChI=1S/C19H19FN6O3/c1-4-29-26-19(27)16-14(5-6-23-25-16)24-15-8-12(20)7-13(17(15)28-3)18-21-9-11(2)10-22-18/h5-10H,4H2,1-3H3,(H,23,24)(H,26,27) |
| InChIKey | WTSDNKPQXLSLTC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|