C19H17ClFN5O3 — CID 175887632
2-chloro-N-ethoxy-4-(5-fluoro-2-methoxy-3-pyrazin-2-ylanilino)pyridine-3-carboxamide (PubChem CID 175887632) has the molecular formula C19H17ClFN5O3 and a molecular weight of 417.83 g/mol. Its IUPAC name is 2-chloro-N-ethoxy-4-(5-fluoro-2-methoxy-3-pyrazin-2-ylanilino)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-ethoxy-4-(5-fluoro-2-methoxy-3-pyrazin-2-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175887632 |
| Molecular Formula | C19H17ClFN5O3 |
| Molecular Weight | 417.83 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-chloro-N-ethoxy-4-(5-fluoro-2-methoxy-3-pyrazin-2-ylanilino)pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1c(Nc2cc(F)cc(-c3cnccn3)c2OC)ccnc1Cl |
| InChI | InChI=1S/C19H17ClFN5O3/c1-3-29-26-19(27)16-13(4-5-24-18(16)20)25-14-9-11(21)8-12(17(14)28-2)15-10-22-6-7-23-15/h4-10H,3H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | ACYCHORVMABQQB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|