About 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid)
1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) (PubChem CID 175967133) has the molecular formula C21H31IO4
and a molecular weight of 474.38 g/mol. Its IUPAC name is 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid).
Molecular Properties
| Compound Name | 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) |
| PubChem CID | 175967133 |
| Molecular Formula | C21H31IO4 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) |
| SMILES | CC1CC(C(=O)O)C1.CC1CC(C(=O)O)C1.Cc1ccc(I)c(C)c1C |
| InChI | InChI=1S/C9H11I.2C6H10O2/c1-6-4-5-9(10)8(3)7(6)2;2*1-4-2-5(3-4)6(7)8/h4-5H,1-3H3;2*4-5H,2-3H2,1H3,(H,7,8) |
| InChIKey | XUXYJMRMYZACCD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid)?
The IUPAC name of 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) (CID 175967133) is 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid).
What is the SMILES notation for 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid)?
The canonical SMILES for 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) is CC1CC(C(=O)O)C1.CC1CC(C(=O)O)C1.Cc1ccc(I)c(C)c1C.
What is the InChIKey of 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid)?
The InChIKey is XUXYJMRMYZACCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11I.2C6H10O2/c1-6-4-5-9(10)8(3)7(6)2;2*1-4-2-5(3-4)6(7)8/h4-5H,1-3H3;2*4-5H,2-3H2,1H3,(H,7,8).
What are the key properties of 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid)?
1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) has a molecular weight of 474.38 g/mol, XLogP of 5.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2,3,4-trimethylbenzene;bis(3-methylcyclobutane-1-carboxylic acid) is sourced from PubChem (CID 175967133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).