C22H28ClN3O — CID 175970224
(3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]indol-2-one;hydrochloride (PubChem CID 175970224) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]indol-2-one;hydrochloride.
| Compound Name | (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 175970224 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3Z)-1-[(4-aminocyclohexyl)methyl]-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]indol-2-one;hydrochloride |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)N(CC3CCC(N)CC3)c3ccccc32)[nH]1.Cl |
| InChI | InChI=1S/C22H27N3O.ClH/c1-14-11-15(2)24-20(14)12-19-18-5-3-4-6-21(18)25(22(19)26)13-16-7-9-17(23)10-8-16;/h3-6,11-12,16-17,24H,7-10,13,23H2,1-2H3;1H/b19-12-; |
| InChIKey | PSDAWZMNYVADDO-JHMJKTBASA-N |
| XLogP | 4.46 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|