C20H24N3O2+ — CID 10292759
[2-[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl]-2-oxoethyl]-trimethylazanium (PubChem CID 10292759) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is [2-[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 10292759 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [2-[(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-2-oxoindol-1-yl]-2-oxoethyl]-trimethylazanium |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)N(C(=O)C[N+](C)(C)C)c3ccccc32)[nH]1 |
| InChI | InChI=1S/C20H23N3O2/c1-13-10-14(2)21-17(13)11-16-15-8-6-7-9-18(15)22(20(16)25)19(24)12-23(3,4)5/h6-11H,12H2,1-5H3/p+1 |
| InChIKey | DZPQMMQIBQGVEN-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|