C21H25N3O2 — CID 11638882
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)indol-2-one (PubChem CID 11638882) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 11638882 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)N(CCN3CCOCC3)c3ccccc32)[nH]1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-13-16(2)22-19(15)14-18-17-5-3-4-6-20(17)24(21(18)25)8-7-23-9-11-26-12-10-23/h3-6,13-14,22H,7-12H2,1-2H3/b18-14- |
| InChIKey | CBPUZXLLDHHDLW-JXAWBTAJSA-N |
| XLogP | 2.85 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|