C30H26N2O5 — CID 66986486
1-butanoyl-3-[[2-[(E)-(1-butanoyl-2-oxoindol-3-ylidene)methyl]furan-3-yl]methylidene]indol-2-one (PubChem CID 66986486) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is 1-butanoyl-3-[[2-[(E)-(1-butanoyl-2-oxoindol-3-ylidene)methyl]furan-3-yl]methylidene]indol-2-one.
| Compound Name | 1-butanoyl-3-[[2-[(E)-(1-butanoyl-2-oxoindol-3-ylidene)methyl]furan-3-yl]methylidene]indol-2-one |
|---|---|
| PubChem CID | 66986486 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1-butanoyl-3-[[2-[(E)-(1-butanoyl-2-oxoindol-3-ylidene)methyl]furan-3-yl]methylidene]indol-2-one |
| SMILES | CCCC(=O)N1C(=O)C(=Cc2ccoc2/C=C2/C(=O)N(C(=O)CCC)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C30H26N2O5/c1-3-9-27(33)31-24-13-7-5-11-20(24)22(29(31)35)17-19-15-16-37-26(19)18-23-21-12-6-8-14-25(21)32(30(23)36)28(34)10-4-2/h5-8,11-18H,3-4,9-10H2,1-2H3/b22-17?,23-18+ |
| InChIKey | IIBHUGIYGSKUPK-MJGZFPFJSA-N |
| XLogP | 5.71 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|