C28H34N4O2 — CID 175973074
methyl 2-[4-(4-benzylpiperazin-1-yl)-1-bicyclo[2.2.2]octanyl]indazole-6-carboxylate (PubChem CID 175973074) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is methyl 2-[4-(4-benzylpiperazin-1-yl)-1-bicyclo[2.2.2]octanyl]indazole-6-carboxylate.
| Compound Name | methyl 2-[4-(4-benzylpiperazin-1-yl)-1-bicyclo[2.2.2]octanyl]indazole-6-carboxylate |
|---|---|
| PubChem CID | 175973074 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | methyl 2-[4-(4-benzylpiperazin-1-yl)-1-bicyclo[2.2.2]octanyl]indazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2cn(C34CCC(N5CCN(Cc6ccccc6)CC5)(CC3)CC4)nc2c1 |
| InChI | InChI=1S/C28H34N4O2/c1-34-26(33)23-7-8-24-21-32(29-25(24)19-23)28-12-9-27(10-13-28,11-14-28)31-17-15-30(16-18-31)20-22-5-3-2-4-6-22/h2-8,19,21H,9-18,20H2,1H3 |
| InChIKey | DMDDTRDRICWURP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |