methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate

C18H18N2O4 — CID 169188076

IUPACmethyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate
SMILESCOC(=O)c1ccc2cn(Cc3cc(OC)cc(OC)c3)nc2c1
InChIInChI=1S/C18H18N2O4/c1-22-15-6-12(7-16(9-15)23-2)10-20-11-14-5-4-13(18(21)24-3)8-17(14)19-20/h4-9,11H,10H2,1-3H3
InChIKeyJAHZHAPQQHDKJW-UHFFFAOYSA-N
MW326.35 g/mol
LogP2.89
Rot. Bonds5

About methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate

methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate (PubChem CID 169188076) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate
PubChem CID169188076
Molecular FormulaC18H18N2O4
Molecular Weight326.35 g/mol
Exact Mass326.13
IUPAC Namemethyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate
SMILESCOC(=O)c1ccc2cn(Cc3cc(OC)cc(OC)c3)nc2c1
InChIInChI=1S/C18H18N2O4/c1-22-15-6-12(7-16(9-15)23-2)10-20-11-14-5-4-13(18(21)24-3)8-17(14)19-20/h4-9,11H,10H2,1-3H3
InChIKeyJAHZHAPQQHDKJW-UHFFFAOYSA-N
XLogP2.89
TPSA62.58 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.35
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate?
The IUPAC name of methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate (CID 169188076) is methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate.
What is the SMILES notation for methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate?
The canonical SMILES for methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate is COC(=O)c1ccc2cn(Cc3cc(OC)cc(OC)c3)nc2c1.
What is the InChIKey of methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate?
The InChIKey is JAHZHAPQQHDKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4/c1-22-15-6-12(7-16(9-15)23-2)10-20-11-14-5-4-13(18(21)24-3)8-17(14)19-20/h4-9,11H,10H2,1-3H3.
What are the key properties of methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate?
methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate has a molecular weight of 326.35 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dimethoxyphenyl)methyl]indazole-6-carboxylate is sourced from PubChem (CID 169188076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).