C18H22N4O2 — CID 175973005
methyl 2-(3-piperazin-1-yl-1-bicyclo[1.1.1]pentanyl)indazole-6-carboxylate (PubChem CID 175973005) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 2-(3-piperazin-1-yl-1-bicyclo[1.1.1]pentanyl)indazole-6-carboxylate.
| Compound Name | methyl 2-(3-piperazin-1-yl-1-bicyclo[1.1.1]pentanyl)indazole-6-carboxylate |
|---|---|
| PubChem CID | 175973005 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | methyl 2-(3-piperazin-1-yl-1-bicyclo[1.1.1]pentanyl)indazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2cn(C34CC(N5CCNCC5)(C3)C4)nc2c1 |
| InChI | InChI=1S/C18H22N4O2/c1-24-16(23)13-2-3-14-9-22(20-15(14)8-13)18-10-17(11-18,12-18)21-6-4-19-5-7-21/h2-3,8-9,19H,4-7,10-12H2,1H3 |
| InChIKey | QFCMZTNWWZHHMX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |