C18H23ClF3NO3 — CID 175975410
tert-butyl 4-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 175975410) has the molecular formula C18H23ClF3NO3 and a molecular weight of 393.83 g/mol. Its IUPAC name is tert-butyl 4-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175975410 |
| Molecular Formula | C18H23ClF3NO3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | tert-butyl 4-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2ccc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClF3NO3/c1-17(2,3)26-16(24)23-8-6-14(7-9-23)25-11-12-4-5-13(10-15(12)19)18(20,21)22/h4-5,10,14H,6-9,11H2,1-3H3 |
| InChIKey | QYLRFXGTBZKPQR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |