C18H16BrFN4O2 — CID 175978784
4-(3-bromo-4-methyl-5-nitro-6-piperidin-1-yl-2-pyridinyl)-2-fluorobenzonitrile (PubChem CID 175978784) has the molecular formula C18H16BrFN4O2 and a molecular weight of 419.25 g/mol. Its IUPAC name is 4-(3-bromo-4-methyl-5-nitro-6-piperidin-1-yl-2-pyridinyl)-2-fluorobenzonitrile.
| Compound Name | 4-(3-bromo-4-methyl-5-nitro-6-piperidin-1-yl-2-pyridinyl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 175978784 |
| Molecular Formula | C18H16BrFN4O2 |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 4-(3-bromo-4-methyl-5-nitro-6-piperidin-1-yl-2-pyridinyl)-2-fluorobenzonitrile |
| SMILES | Cc1c(Br)c(-c2ccc(C#N)c(F)c2)nc(N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16BrFN4O2/c1-11-15(19)16(12-5-6-13(10-21)14(20)9-12)22-18(17(11)24(25)26)23-7-3-2-4-8-23/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | DTHMVLGJJQMCFL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|