C12H11F15O2 — CID 175979974
4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)pentan-3-yl]oxy-2-methylbutan-2-ol (PubChem CID 175979974) has the molecular formula C12H11F15O2 and a molecular weight of 472.19 g/mol. Its IUPAC name is 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)pentan-3-yl]oxy-2-methylbutan-2-ol.
| Compound Name | 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)pentan-3-yl]oxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 175979974 |
| Molecular Formula | C12H11F15O2 |
| Molecular Weight | 472.19 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)pentan-3-yl]oxy-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCOC(C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F15O2/c1-5(2,28)3-4-29-6(7(13,14)10(19,20)21,8(15,16)11(22,23)24)9(17,18)12(25,26)27/h28H,3-4H2,1-2H3 |
| InChIKey | OHUWAGLEIIWUMJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.19 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|