C9H10F3NO — CID 175983566
1-methyl-3-(3,3,3-trifluoroprop-1-ynyl)cyclobutane-1-carboxamide (PubChem CID 175983566) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 1-methyl-3-(3,3,3-trifluoroprop-1-ynyl)cyclobutane-1-carboxamide.
| Compound Name | 1-methyl-3-(3,3,3-trifluoroprop-1-ynyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 175983566 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 1-methyl-3-(3,3,3-trifluoroprop-1-ynyl)cyclobutane-1-carboxamide |
| SMILES | CC1(C(N)=O)CC(C#CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F3NO/c1-8(7(13)14)4-6(5-8)2-3-9(10,11)12/h6H,4-5H2,1H3,(H2,13,14) |
| InChIKey | YUVSDMGOWHLXFM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|