About 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide
2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 175992393) has the molecular formula C8H12F3NO2
and a molecular weight of 212.19 g/mol. Its IUPAC name is 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
Molecular Properties
| Compound Name | 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| PubChem CID | 175992393 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | [2H]C1(C(N)=O)CC(C)C(C)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H12F3NO2/c1-4-3-5(6(12)13)14-7(4,2)8(9,10)11/h4-5H,3H2,1-2H3,(H2,12,13)/i5D |
| InChIKey | VPTJJMXMNIPSNI-UICOGKGYSA-N |
| XLogP | 1.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide?
The IUPAC name of 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (CID 175992393) is 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
What is the SMILES notation for 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide?
The canonical SMILES for 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide is [2H]C1(C(N)=O)CC(C)C(C)(C(F)(F)F)O1.
What is the InChIKey of 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide?
The InChIKey is VPTJJMXMNIPSNI-UICOGKGYSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-4-3-5(6(12)13)14-7(4,2)8(9,10)11/h4-5H,3H2,1-2H3,(H2,12,13)/i5D.
What are the key properties of 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide?
2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide has a molecular weight of 212.19 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide is sourced from PubChem (CID 175992393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).