About dioxirane-3-carboxamide
dioxirane-3-carboxamide (PubChem CID 101107076) has the molecular formula C2H3NO3
and a molecular weight of 89.05 g/mol. Its IUPAC name is dioxirane-3-carboxamide.
Molecular Properties
| Compound Name | dioxirane-3-carboxamide |
| PubChem CID | 101107076 |
| Molecular Formula | C2H3NO3 |
| Molecular Weight | 89.05 g/mol |
| Exact Mass | 89.01 |
| IUPAC Name | dioxirane-3-carboxamide |
| SMILES | NC(=O)C1OO1 |
| InChI | InChI=1S/C2H3NO3/c3-1(4)2-5-6-2/h2H,(H2,3,4) |
| InChIKey | AERHHQUZBJRRCC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.05 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dioxirane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxirane-3-carboxamide?
The IUPAC name of dioxirane-3-carboxamide (CID 101107076) is dioxirane-3-carboxamide.
What is the SMILES notation for dioxirane-3-carboxamide?
The canonical SMILES for dioxirane-3-carboxamide is NC(=O)C1OO1.
What is the InChIKey of dioxirane-3-carboxamide?
The InChIKey is AERHHQUZBJRRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO3/c3-1(4)2-5-6-2/h2H,(H2,3,4).
What are the key properties of dioxirane-3-carboxamide?
dioxirane-3-carboxamide has a molecular weight of 89.05 g/mol, XLogP of -1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxirane-3-carboxamide is sourced from PubChem (CID 101107076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).