C15H11F2N7O2 — CID 175984328
N-[1-[4-(azidomethyl)phenyl]-3-(difluoromethyl)pyrazol-4-yl]-1,3-oxazole-4-carboxamide (PubChem CID 175984328) has the molecular formula C15H11F2N7O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[1-[4-(azidomethyl)phenyl]-3-(difluoromethyl)pyrazol-4-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-[4-(azidomethyl)phenyl]-3-(difluoromethyl)pyrazol-4-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 175984328 |
| Molecular Formula | C15H11F2N7O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[1-[4-(azidomethyl)phenyl]-3-(difluoromethyl)pyrazol-4-yl]-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccc(-n2cc(NC(=O)c3cocn3)c(C(F)F)n2)cc1 |
| InChI | InChI=1S/C15H11F2N7O2/c16-14(17)13-11(21-15(25)12-7-26-8-19-12)6-24(22-13)10-3-1-9(2-4-10)5-20-23-18/h1-4,6-8,14H,5H2,(H,21,25) |
| InChIKey | LGUOZXRBBWXSFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|