C16H23N5 — CID 175986880
4-methyl-4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-triene (PubChem CID 175986880) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-methyl-4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-triene.
| Compound Name | 4-methyl-4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-triene |
|---|---|
| PubChem CID | 175986880 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-methyl-4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-triene |
| SMILES | CN1CC2C3CCC(CN2c2c1cnc1c2CCNC1)N3 |
| InChI | InChI=1S/C16H23N5/c1-20-9-15-12-3-2-10(19-12)8-21(15)16-11-4-5-17-6-13(11)18-7-14(16)20/h7,10,12,15,17,19H,2-6,8-9H2,1H3 |
| InChIKey | PZSVWQRKLUMRLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |