C15H23N3O5 — CID 175990893
tert-butyl-[5-ethoxy-2-[(2-methoxyacetyl)amino]-4-pyridinyl]carbamic acid (PubChem CID 175990893) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl-[5-ethoxy-2-[(2-methoxyacetyl)amino]-4-pyridinyl]carbamic acid.
| Compound Name | tert-butyl-[5-ethoxy-2-[(2-methoxyacetyl)amino]-4-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 175990893 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl-[5-ethoxy-2-[(2-methoxyacetyl)amino]-4-pyridinyl]carbamic acid |
| SMILES | CCOc1cnc(NC(=O)COC)cc1N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H23N3O5/c1-6-23-11-8-16-12(17-13(19)9-22-5)7-10(11)18(14(20)21)15(2,3)4/h7-8H,6,9H2,1-5H3,(H,20,21)(H,16,17,19) |
| InChIKey | IICFBONLXSGYQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |