C16H25N3O4 — CID 175990670
[2-acetamido-5-(3-methoxypropyl)-4-pyridinyl]-tert-butylcarbamic acid (PubChem CID 175990670) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-acetamido-5-(3-methoxypropyl)-4-pyridinyl]-tert-butylcarbamic acid.
| Compound Name | [2-acetamido-5-(3-methoxypropyl)-4-pyridinyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 175990670 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | [2-acetamido-5-(3-methoxypropyl)-4-pyridinyl]-tert-butylcarbamic acid |
| SMILES | COCCCc1cnc(NC(C)=O)cc1N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H25N3O4/c1-11(20)18-14-9-13(19(15(21)22)16(2,3)4)12(10-17-14)7-6-8-23-5/h9-10H,6-8H2,1-5H3,(H,21,22)(H,17,18,20) |
| InChIKey | GGAZHRJRHHQUAK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|