C42H78O6 — CID 175991893
(2R,3R,4R,5S)-1-non-1-enoxy-3,5-bis(non-1-enyl)pentadec-7-ene-2,3,4,5,6-pentol (PubChem CID 175991893) has the molecular formula C42H78O6 and a molecular weight of 679.08 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-non-1-enoxy-3,5-bis(non-1-enyl)pentadec-7-ene-2,3,4,5,6-pentol.
| Compound Name | (2R,3R,4R,5S)-1-non-1-enoxy-3,5-bis(non-1-enyl)pentadec-7-ene-2,3,4,5,6-pentol |
|---|---|
| PubChem CID | 175991893 |
| Molecular Formula | C42H78O6 |
| Molecular Weight | 679.08 g/mol |
| Exact Mass | 678.58 |
| IUPAC Name | (2R,3R,4R,5S)-1-non-1-enoxy-3,5-bis(non-1-enyl)pentadec-7-ene-2,3,4,5,6-pentol |
| SMILES | CCCCCCCC=COC[C@@H](O)[C@](O)(C=CCCCCCCC)[C@H](O)[C@](O)(C=CCCCCCCC)C(O)C=CCCCCCCC |
| InChI | InChI=1S/C42H78O6/c1-5-9-13-17-21-25-29-33-38(43)41(46,34-30-26-22-18-14-10-6-2)40(45)42(47,35-31-27-23-19-15-11-7-3)39(44)37-48-36-32-28-24-20-16-12-8-4/h29-36,38-40,43-47H,5-28,37H2,1-4H3/t38?,39-,40-,41+,42-/m1/s1 |
| InChIKey | CSHOXXPOFNLVSX-JRRYUONBSA-N |
| XLogP | 10.17 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.08 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|