C19H17F3N2O4 — CID 175994129
2-[2-hydroxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-1-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 175994129) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-1-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 2-[2-hydroxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175994129 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[2-hydroxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)CCC1(C(N)=O)c1cc(Oc2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C19H17F3N2O4/c1-24-16(26)8-9-18(24,17(23)27)14-10-13(6-7-15(14)25)28-12-4-2-11(3-5-12)19(20,21)22/h2-7,10,25H,8-9H2,1H3,(H2,23,27) |
| InChIKey | QLWBOXPQUVSCRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|