C24H13ClF5N3O4 — CID 175994754
N-[7-(2-chloro-5-fluorophenyl)-3,3-dideuterio-2,9-dioxo-7,8-dihydro-1H-pyrrolo[3,4-f][1,4]benzoxazin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 175994754) has the molecular formula C24H13ClF5N3O4 and a molecular weight of 539.84 g/mol. Its IUPAC name is N-[7-(2-chloro-5-fluorophenyl)-3,3-dideuterio-2,9-dioxo-7,8-dihydro-1H-pyrrolo[3,4-f][1,4]benzoxazin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[7-(2-chloro-5-fluorophenyl)-3,3-dideuterio-2,9-dioxo-7,8-dihydro-1H-pyrrolo[3,4-f][1,4]benzoxazin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175994754 |
| Molecular Formula | C24H13ClF5N3O4 |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N-[7-(2-chloro-5-fluorophenyl)-3,3-dideuterio-2,9-dioxo-7,8-dihydro-1H-pyrrolo[3,4-f][1,4]benzoxazin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | [2H]C1([2H])Oc2cc(NC(=O)c3cc(F)cc(C(F)(F)F)c3)c3c(c2NC1=O)C(=O)NC3c1cc(F)ccc1Cl |
| InChI | InChI=1S/C24H13ClF5N3O4/c25-14-2-1-11(26)6-13(14)20-18-15(7-16-21(19(18)23(36)33-20)32-17(34)8-37-16)31-22(35)9-3-10(24(28,29)30)5-12(27)4-9/h1-7,20H,8H2,(H,31,35)(H,32,34)(H,33,36)/i8D2 |
| InChIKey | UKVUKUCIUWQCHF-MGVXTIMCSA-N |
| XLogP | 5.05 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |