C26H16ClF7N4O3 — CID 175994790
N-[7-(2-chloro-5-fluorophenyl)-4-(2,2-difluoroethyl)-2,9-dioxo-1,3,7,8-tetrahydropyrrolo[3,4-f]quinoxalin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 175994790) has the molecular formula C26H16ClF7N4O3 and a molecular weight of 600.88 g/mol. Its IUPAC name is N-[7-(2-chloro-5-fluorophenyl)-4-(2,2-difluoroethyl)-2,9-dioxo-1,3,7,8-tetrahydropyrrolo[3,4-f]quinoxalin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[7-(2-chloro-5-fluorophenyl)-4-(2,2-difluoroethyl)-2,9-dioxo-1,3,7,8-tetrahydropyrrolo[3,4-f]quinoxalin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175994790 |
| Molecular Formula | C26H16ClF7N4O3 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | N-[7-(2-chloro-5-fluorophenyl)-4-(2,2-difluoroethyl)-2,9-dioxo-1,3,7,8-tetrahydropyrrolo[3,4-f]quinoxalin-6-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C1CN(CC(F)F)c2cc(NC(=O)c3cc(F)cc(C(F)(F)F)c3)c3c(c2N1)C(=O)NC3c1cc(F)ccc1Cl |
| InChI | InChI=1S/C26H16ClF7N4O3/c27-15-2-1-12(28)6-14(15)22-20-16(35-24(40)10-3-11(26(32,33)34)5-13(29)4-10)7-17-23(21(20)25(41)37-22)36-19(39)9-38(17)8-18(30)31/h1-7,18,22H,8-9H2,(H,35,40)(H,36,39)(H,37,41) |
| InChIKey | OQBPHDLCPRZAPU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |