C24H32N3O4S- — CID 175995556
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[4-[2-phenylethyl(sulfinato)amino]phenyl]methyl]piperazine (PubChem CID 175995556) has the molecular formula C24H32N3O4S- and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[4-[2-phenylethyl(sulfinato)amino]phenyl]methyl]piperazine.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[4-[2-phenylethyl(sulfinato)amino]phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 175995556 |
| Molecular Formula | C24H32N3O4S- |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[4-[2-phenylethyl(sulfinato)amino]phenyl]methyl]piperazine |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(N(CCc3ccccc3)S(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H33N3O4S/c1-24(2,3)31-23(28)26-17-15-25(16-18-26)19-21-9-11-22(12-10-21)27(32(29)30)14-13-20-7-5-4-6-8-20/h4-12H,13-19H2,1-3H3,(H,29,30)/p-1 |
| InChIKey | DUNPNIZDEUNVGK-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|