C29H32FN5O2 — CID 175995900
(1R,9S)-6-(2-fluoro-5-hydroxyphenyl)-12-propan-2-yl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carbonitrile (PubChem CID 175995900) has the molecular formula C29H32FN5O2 and a molecular weight of 501.61 g/mol. Its IUPAC name is (1R,9S)-6-(2-fluoro-5-hydroxyphenyl)-12-propan-2-yl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9S)-6-(2-fluoro-5-hydroxyphenyl)-12-propan-2-yl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 175995900 |
| Molecular Formula | C29H32FN5O2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (1R,9S)-6-(2-fluoro-5-hydroxyphenyl)-12-propan-2-yl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)ccc5F)c3C#N)C[C@@H]3CC[C@H]4N3C(C)C)C2)C1 |
| InChI | InChI=1S/C29H32FN5O2/c1-4-25(37)34-15-29(16-34)9-10-33(14-29)28-22(13-31)26(20-12-19(36)6-7-23(20)30)21-11-18-5-8-24(27(21)32-28)35(18)17(2)3/h4,6-7,12,17-18,24,36H,1,5,8-11,14-16H2,2-3H3/t18-,24+/m0/s1 |
| InChIKey | YRRNJGNGWVAHRU-MHECFPHRSA-N |
| XLogP | 4.16 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|