C30H31F3N4O2 — CID 167037985
(1R,9R)-6-[3-methoxy-5-(trifluoromethyl)phenyl]-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037985) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is (1R,9R)-6-[3-methoxy-5-(trifluoromethyl)phenyl]-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-6-[3-methoxy-5-(trifluoromethyl)phenyl]-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037985 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (1R,9R)-6-[3-methoxy-5-(trifluoromethyl)phenyl]-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(OC)cc(C(F)(F)F)c5)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C30H31F3N4O2/c1-5-24(38)37-15-29(16-37)6-7-36(14-29)27-22(13-34)25(17-8-19(30(31,32)33)10-20(9-17)39-4)21-11-18-12-23(26(21)35-27)28(18,2)3/h5,8-10,18,23H,1,6-7,11-12,14-16H2,2-4H3/t18-,23-/m0/s1 |
| InChIKey | IUZRIUVUCXADLQ-MBSDFSHPSA-N |
| XLogP | 5.56 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|