C25H29N3O3 — CID 175998253
[4-[1-cyclopropyloxy-2-(oxan-2-yloxy)-1-phenylethyl]quinazolin-2-yl]methanamine (PubChem CID 175998253) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [4-[1-cyclopropyloxy-2-(oxan-2-yloxy)-1-phenylethyl]quinazolin-2-yl]methanamine.
| Compound Name | [4-[1-cyclopropyloxy-2-(oxan-2-yloxy)-1-phenylethyl]quinazolin-2-yl]methanamine |
|---|---|
| PubChem CID | 175998253 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [4-[1-cyclopropyloxy-2-(oxan-2-yloxy)-1-phenylethyl]quinazolin-2-yl]methanamine |
| SMILES | NCc1nc(C(COC2CCCCO2)(OC2CC2)c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C25H29N3O3/c26-16-22-27-21-11-5-4-10-20(21)24(28-22)25(31-19-13-14-19,18-8-2-1-3-9-18)17-30-23-12-6-7-15-29-23/h1-5,8-11,19,23H,6-7,12-17,26H2 |
| InChIKey | UVUJUCMIMMHWQE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |