About 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid
3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid (PubChem CID 175998774) has the molecular formula C11H14BrNO3
and a molecular weight of 288.14 g/mol. Its IUPAC name is 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid |
| PubChem CID | 175998774 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(Br)c(OCC(C)(C)C(=O)O)n1 |
| InChI | InChI=1S/C11H14BrNO3/c1-7-4-5-8(12)9(13-7)16-6-11(2,3)10(14)15/h4-5H,6H2,1-3H3,(H,14,15) |
| InChIKey | BHHAVEKUJWKGEK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid (CID 175998774) is 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid is Cc1ccc(Br)c(OCC(C)(C)C(=O)O)n1.
What is the InChIKey of 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid?
The InChIKey is BHHAVEKUJWKGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO3/c1-7-4-5-8(12)9(13-7)16-6-11(2,3)10(14)15/h4-5H,6H2,1-3H3,(H,14,15).
What are the key properties of 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid?
3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid has a molecular weight of 288.14 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-bromo-6-methyl-2-pyridinyl)oxy]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 175998774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).