C12H16BrF2NO2 — CID 175999532
tert-butyl (1R,4R,7R)-7-bromo-6-(difluoromethylidene)-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 175999532) has the molecular formula C12H16BrF2NO2 and a molecular weight of 324.17 g/mol. Its IUPAC name is tert-butyl (1R,4R,7R)-7-bromo-6-(difluoromethylidene)-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R,7R)-7-bromo-6-(difluoromethylidene)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 175999532 |
| Molecular Formula | C12H16BrF2NO2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | tert-butyl (1R,4R,7R)-7-bromo-6-(difluoromethylidene)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(=C(F)F)[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C12H16BrF2NO2/c1-12(2,3)18-11(17)16-5-6-4-7(10(14)15)9(16)8(6)13/h6,8-9H,4-5H2,1-3H3/t6-,8-,9-/m1/s1 |
| InChIKey | KWWRPOUZGKUWNL-FTLITQJKSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|