C17H33N2+ — CID 175999553
4-dodecyl-2,3-dimethyl-1H-imidazol-3-ium (PubChem CID 175999553) has the molecular formula C17H33N2+ and a molecular weight of 265.46 g/mol. Its IUPAC name is 4-dodecyl-2,3-dimethyl-1H-imidazol-3-ium.
| Compound Name | 4-dodecyl-2,3-dimethyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 175999553 |
| Molecular Formula | C17H33N2+ |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 265.26 |
| IUPAC Name | 4-dodecyl-2,3-dimethyl-1H-imidazol-3-ium |
| SMILES | CCCCCCCCCCCCc1c[nH]c(C)[n+]1C |
| InChI | InChI=1S/C17H32N2/c1-4-5-6-7-8-9-10-11-12-13-14-17-15-18-16(2)19(17)3/h15H,4-14H2,1-3H3/p+1 |
| InChIKey | YJNXBQNMCCGVGK-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|