C10H19N4+ — CID 137093498
(2,3-dimethyl-1H-imidazol-3-ium-4-yl)-pentyldiazene (PubChem CID 137093498) has the molecular formula C10H19N4+ and a molecular weight of 195.29 g/mol. Its IUPAC name is (2,3-dimethyl-1H-imidazol-3-ium-4-yl)-pentyldiazene.
| Compound Name | (2,3-dimethyl-1H-imidazol-3-ium-4-yl)-pentyldiazene |
|---|---|
| PubChem CID | 137093498 |
| Molecular Formula | C10H19N4+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2,3-dimethyl-1H-imidazol-3-ium-4-yl)-pentyldiazene |
| SMILES | CCCCC/N=N/c1c[nH]c(C)[n+]1C |
| InChI | InChI=1S/C10H18N4/c1-4-5-6-7-12-13-10-8-11-9(2)14(10)3/h8H,4-7H2,1-3H3/p+1/b13-12+ |
| InChIKey | HEWQWRRIJJDQTP-OUKQBFOZSA-O |
| XLogP | 2.42 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|