C25H29N3O3 — CID 176503447
(3aS,6aR)-2-[2-hydroxy-3-[4-(2-methylpyrimidin-5-yl)naphthalen-2-yl]oxypropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 176503447) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-hydroxy-3-[4-(2-methylpyrimidin-5-yl)naphthalen-2-yl]oxypropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aS,6aR)-2-[2-hydroxy-3-[4-(2-methylpyrimidin-5-yl)naphthalen-2-yl]oxypropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 176503447 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (3aS,6aR)-2-[2-hydroxy-3-[4-(2-methylpyrimidin-5-yl)naphthalen-2-yl]oxypropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | Cc1ncc(-c2cc(OCC(O)CN3C[C@H]4CC(O)C[C@H]4C3)cc3ccccc23)cn1 |
| InChI | InChI=1S/C25H29N3O3/c1-16-26-10-20(11-27-16)25-9-23(8-17-4-2-3-5-24(17)25)31-15-22(30)14-28-12-18-6-21(29)7-19(18)13-28/h2-5,8-11,18-19,21-22,29-30H,6-7,12-15H2,1H3/t18-,19+,21?,22? |
| InChIKey | MBBLSCIMLIYXHK-IVCWUUCSSA-N |
| XLogP | 3.05 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |