C20H18F3N3O3 — CID 176504859
N-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-5-(trifluoromethyl)phenyl]-3-methoxypyridine-4-carboxamide (PubChem CID 176504859) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is N-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-5-(trifluoromethyl)phenyl]-3-methoxypyridine-4-carboxamide.
| Compound Name | N-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-5-(trifluoromethyl)phenyl]-3-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 176504859 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-5-(trifluoromethyl)phenyl]-3-methoxypyridine-4-carboxamide |
| SMILES | COc1cnccc1C(=O)Nc1cc(C(=O)N2CC=CCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3N3O3/c1-29-17-12-24-6-5-16(17)18(27)25-15-10-13(9-14(11-15)20(21,22)23)19(28)26-7-3-2-4-8-26/h2-3,5-6,9-12H,4,7-8H2,1H3,(H,25,27) |
| InChIKey | WQWVKRMCDCZARI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|