C21H31N3O3S — CID 176506123
7-(azepan-1-ylsulfonyl)-2-(2-phenylethyl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 176506123) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 7-(azepan-1-ylsulfonyl)-2-(2-phenylethyl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 7-(azepan-1-ylsulfonyl)-2-(2-phenylethyl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 176506123 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 7-(azepan-1-ylsulfonyl)-2-(2-phenylethyl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C1N(CCc2ccccc2)CCC12CCN(S(=O)(=O)N1CCCCCC1)C2 |
| InChI | InChI=1S/C21H31N3O3S/c25-20-21(11-16-22(20)15-10-19-8-4-3-5-9-19)12-17-24(18-21)28(26,27)23-13-6-1-2-7-14-23/h3-5,8-9H,1-2,6-7,10-18H2 |
| InChIKey | MVUOBQBALYWSRU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |