C21H24N6OS — CID 176506615
(1R,9S)-5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 176506615) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is (1R,9S)-5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 176506615 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (1R,9S)-5-[[methyl(1,3-thiazol-2-ylmethyl)amino]methyl]-11-pyrazin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(Cc1nccs1)Cc1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(c2cnccn2)C1 |
| InChI | InChI=1S/C21H24N6OS/c1-25(14-20-24-6-7-29-20)12-16-2-3-18-17-8-15(11-27(18)21(16)28)10-26(13-17)19-9-22-4-5-23-19/h2-7,9,15,17H,8,10-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | IJLDGXJLJQOPTF-DOTOQJQBSA-N |
| XLogP | 2.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |