C19H20F3N3O5 — CID 176511225
(2S,3R)-3-amino-2-hydroxy-N-[(1S)-2-(hydroxyamino)-2-oxo-1-[3-(trifluoromethoxy)phenyl]ethyl]-4-phenylbutanamide (PubChem CID 176511225) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-hydroxy-N-[(1S)-2-(hydroxyamino)-2-oxo-1-[3-(trifluoromethoxy)phenyl]ethyl]-4-phenylbutanamide.
| Compound Name | (2S,3R)-3-amino-2-hydroxy-N-[(1S)-2-(hydroxyamino)-2-oxo-1-[3-(trifluoromethoxy)phenyl]ethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 176511225 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2S,3R)-3-amino-2-hydroxy-N-[(1S)-2-(hydroxyamino)-2-oxo-1-[3-(trifluoromethoxy)phenyl]ethyl]-4-phenylbutanamide |
| SMILES | N[C@H](Cc1ccccc1)[C@H](O)C(=O)N[C@H](C(=O)NO)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O5/c20-19(21,22)30-13-8-4-7-12(10-13)15(17(27)25-29)24-18(28)16(26)14(23)9-11-5-2-1-3-6-11/h1-8,10,14-16,26,29H,9,23H2,(H,24,28)(H,25,27)/t14-,15+,16+/m1/s1 |
| InChIKey | DKKUUTRVNIDQDT-PMPSAXMXSA-N |
| XLogP | 1.18 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|