C28H31BN4O3S — CID 176514138
3,5-dimethyl-4-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]oxy]benzonitrile (PubChem CID 176514138) has the molecular formula C28H31BN4O3S and a molecular weight of 514.46 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]oxy]benzonitrile.
| Compound Name | 3,5-dimethyl-4-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 176514138 |
| Molecular Formula | C28H31BN4O3S |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 3,5-dimethyl-4-[[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]oxy]benzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)nc2c1SCCC2 |
| InChI | InChI=1S/C28H31BN4O3S/c1-17-14-19(16-30)15-18(2)23(17)34-25-24-22(8-7-13-37-24)32-26(33-25)31-21-11-9-20(10-12-21)29-35-27(3,4)28(5,6)36-29/h9-12,14-15H,7-8,13H2,1-6H3,(H,31,32,33) |
| InChIKey | AEVIQERAAASKCK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|