C18H19N5O5 — CID 176515423
[3-(5-methyl-1,3-oxazol-2-yl)-1-propan-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 176515423) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is [3-(5-methyl-1,3-oxazol-2-yl)-1-propan-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [3-(5-methyl-1,3-oxazol-2-yl)-1-propan-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 176515423 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [3-(5-methyl-1,3-oxazol-2-yl)-1-propan-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | Cc1cnc(-c2nn(C(C)C)c3c2CN(C(=O)c2ccc([N+](=O)[O-])o2)CC3)o1 |
| InChI | InChI=1S/C18H19N5O5/c1-10(2)22-13-6-7-21(18(24)14-4-5-15(28-14)23(25)26)9-12(13)16(20-22)17-19-8-11(3)27-17/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | WDKNUHHMAICXLW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 120.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|