C17H17N5O5 — CID 176515447
(5-nitrofuran-2-yl)-[3-(1,3-oxazol-5-yl)-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 176515447) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)-[3-(1,3-oxazol-5-yl)-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | (5-nitrofuran-2-yl)-[3-(1,3-oxazol-5-yl)-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 176515447 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (5-nitrofuran-2-yl)-[3-(1,3-oxazol-5-yl)-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | CCCn1nc(-c2cnco2)c2c1CCN(C(=O)c1ccc([N+](=O)[O-])o1)C2 |
| InChI | InChI=1S/C17H17N5O5/c1-2-6-21-12-5-7-20(17(23)13-3-4-15(27-13)22(24)25)9-11(12)16(19-21)14-8-18-10-26-14/h3-4,8,10H,2,5-7,9H2,1H3 |
| InChIKey | CXAPVOYMVRVPGZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|