C19H19N5O3 — CID 176521668
1-butyl-3-[[5-(ethenylideneamino)-2-hydroxyphenyl]diazenyl]-6-hydroxy-5-isocyano-4-methylpyridin-2-one (PubChem CID 176521668) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-butyl-3-[[5-(ethenylideneamino)-2-hydroxyphenyl]diazenyl]-6-hydroxy-5-isocyano-4-methylpyridin-2-one.
| Compound Name | 1-butyl-3-[[5-(ethenylideneamino)-2-hydroxyphenyl]diazenyl]-6-hydroxy-5-isocyano-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 176521668 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-butyl-3-[[5-(ethenylideneamino)-2-hydroxyphenyl]diazenyl]-6-hydroxy-5-isocyano-4-methylpyridin-2-one |
| SMILES | [C-]#[N+]c1c(C)c(/N=N/c2cc(N=C=C)ccc2O)c(=O)n(CCCC)c1O |
| InChI | InChI=1S/C19H19N5O3/c1-5-7-10-24-18(26)16(20-4)12(3)17(19(24)27)23-22-14-11-13(21-6-2)8-9-15(14)25/h8-9,11,25-26H,2,5,7,10H2,1,3H3/b23-22+ |
| InChIKey | XOPGKTVTPSPCLR-GHVJWSGMSA-N |
| XLogP | 4.82 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|