C15H13N5O5 — CID 135608384
1-ethyl-6-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]-5-isocyano-4-methylpyridin-2-one (PubChem CID 135608384) has the molecular formula C15H13N5O5 and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-ethyl-6-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]-5-isocyano-4-methylpyridin-2-one.
| Compound Name | 1-ethyl-6-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]-5-isocyano-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 135608384 |
| Molecular Formula | C15H13N5O5 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-ethyl-6-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]-5-isocyano-4-methylpyridin-2-one |
| SMILES | [C-]#[N+]c1c(C)c(/N=N/c2cc([N+](=O)[O-])ccc2O)c(=O)n(CC)c1O |
| InChI | InChI=1S/C15H13N5O5/c1-4-19-14(22)12(16-3)8(2)13(15(19)23)18-17-10-7-9(20(24)25)5-6-11(10)21/h5-7,21-22H,4H2,1-2H3/b18-17+ |
| InChIKey | JDUBBSILPWPWQV-ISLYRVAYSA-N |
| XLogP | 3.46 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|