C14H17N5O4 — CID 135985786
5-tert-butyl-4-[(2-hydroxy-5-nitrophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one (PubChem CID 135985786) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-tert-butyl-4-[(2-hydroxy-5-nitrophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one.
| Compound Name | 5-tert-butyl-4-[(2-hydroxy-5-nitrophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135985786 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-tert-butyl-4-[(2-hydroxy-5-nitrophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one |
| SMILES | Cn1[nH]c(C(C)(C)C)c(/N=N/c2cc([N+](=O)[O-])ccc2O)c1=O |
| InChI | InChI=1S/C14H17N5O4/c1-14(2,3)12-11(13(21)18(4)17-12)16-15-9-7-8(19(22)23)5-6-10(9)20/h5-7,17,20H,1-4H3/b16-15+ |
| InChIKey | FGQLSTJHGAVXHS-FOCLMDBBSA-N |
| XLogP | 3.04 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|