4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid

C8H14O4Si — CID 176528897

IUPAC4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid
SMILESCOC(OC)[SiH2]C=C=C(C)C(=O)O
InChIInChI=1S/C8H14O4Si/c1-6(7(9)10)4-5-13-8(11-2)12-3/h5,8H,13H2,1-3H3,(H,9,10)
InChIKeyVVOFAIYWSGITCH-UHFFFAOYSA-N
MW202.28 g/mol
LogP-0.12
Rot. Bonds5

About 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid

4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid (PubChem CID 176528897) has the molecular formula C8H14O4Si and a molecular weight of 202.28 g/mol. Its IUPAC name is 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid.

Molecular Properties

Compound Name4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid
PubChem CID176528897
Molecular FormulaC8H14O4Si
Molecular Weight202.28 g/mol
Exact Mass202.07
IUPAC Name4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid
SMILESCOC(OC)[SiH2]C=C=C(C)C(=O)O
InChIInChI=1S/C8H14O4Si/c1-6(7(9)10)4-5-13-8(11-2)12-3/h5,8H,13H2,1-3H3,(H,9,10)
InChIKeyVVOFAIYWSGITCH-UHFFFAOYSA-N
XLogP-0.12
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.28
LogP ≤ 5-0.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid?
The IUPAC name of 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid (CID 176528897) is 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid.
What is the SMILES notation for 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid?
The canonical SMILES for 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid is COC(OC)[SiH2]C=C=C(C)C(=O)O.
What is the InChIKey of 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid?
The InChIKey is VVOFAIYWSGITCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4Si/c1-6(7(9)10)4-5-13-8(11-2)12-3/h5,8H,13H2,1-3H3,(H,9,10).
What are the key properties of 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid?
4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid has a molecular weight of 202.28 g/mol, XLogP of -0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethoxymethylsilyl)-2-methylbuta-2,3-dienoic acid is sourced from PubChem (CID 176528897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).