C35H38F6N5O2+ — CID 176529317
1-butyl-N-[3-[2-[4-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-methylpyridine-2-carboxamide (PubChem CID 176529317) has the molecular formula C35H38F6N5O2+ and a molecular weight of 674.71 g/mol. Its IUPAC name is 1-butyl-N-[3-[2-[4-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-methylpyridine-2-carboxamide.
| Compound Name | 1-butyl-N-[3-[2-[4-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176529317 |
| Molecular Formula | C35H38F6N5O2+ |
| Molecular Weight | 674.71 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 1-butyl-N-[3-[2-[4-[(1-butyl-3-methylimidazol-3-ium-2-carbonyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-methylpyridine-2-carboxamide |
| SMILES | CCCCN1C=CC(C)=C=C1C(=O)Nc1cccc(C(c2ccc(NC(=O)c3n(CCCC)cc[n+]3C)cc2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C35H37F6N5O2/c1-5-7-17-45-19-16-24(3)22-29(45)30(47)43-28-11-9-10-26(23-28)33(34(36,37)38,35(39,40)41)25-12-14-27(15-13-25)42-31(48)32-44(4)20-21-46(32)18-8-6-2/h9-16,19-21,23H,5-8,17-18H2,1-4H3,(H-,42,43,47,48)/p+1 |
| InChIKey | GBQKJOKXLJUZNS-UHFFFAOYSA-O |
| XLogP | 7.77 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|