C13H16N2 — CID 176530268
5-ethyl-6-prop-2-enyl-2,7-dihydro-1H-1,8-naphthyridine (PubChem CID 176530268) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-ethyl-6-prop-2-enyl-2,7-dihydro-1H-1,8-naphthyridine.
| Compound Name | 5-ethyl-6-prop-2-enyl-2,7-dihydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 176530268 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-ethyl-6-prop-2-enyl-2,7-dihydro-1H-1,8-naphthyridine |
| SMILES | C=CCC1=C(CC)C2=C=CCNC2=NC1 |
| InChI | InChI=1S/C13H16N2/c1-3-6-10-9-15-13-12(11(10)4-2)7-5-8-14-13/h3,5H,1,4,6,8-9H2,2H3,(H,14,15) |
| InChIKey | GVIOCPWDOPYQMR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|