C18H21NO3S — CID 176531551
butyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate (PubChem CID 176531551) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is butyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate.
| Compound Name | butyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 176531551 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | butyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(Nc2ccc(C)c(C)c2)SCC1=C=O |
| InChI | InChI=1S/C18H21NO3S/c1-4-5-8-22-18(21)16-14(10-20)11-23-17(16)19-15-7-6-12(2)13(3)9-15/h6-7,9,19H,4-5,8,11H2,1-3H3 |
| InChIKey | JHUAWRWTCNZUJZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|