C19H17NO3S — CID 176531554
propyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate (PubChem CID 176531554) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is propyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate.
| Compound Name | propyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 176531554 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | propyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
| SMILES | CCCOC(=O)C1=C(Nc2ccc3ccccc3c2)SCC1=C=O |
| InChI | InChI=1S/C19H17NO3S/c1-2-9-23-19(22)17-15(11-21)12-24-18(17)20-16-8-7-13-5-3-4-6-14(13)10-16/h3-8,10,20H,2,9,12H2,1H3 |
| InChIKey | QIIJHSLWBVCUSH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|