C19H18F3NO2S — CID 3585805
methyl 3-benzylsulfanyl-3-(4-methylanilino)-2-(trifluoromethyl)prop-2-enoate (PubChem CID 3585805) has the molecular formula C19H18F3NO2S and a molecular weight of 381.42 g/mol. Its IUPAC name is methyl 3-benzylsulfanyl-3-(4-methylanilino)-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | methyl 3-benzylsulfanyl-3-(4-methylanilino)-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 3585805 |
| Molecular Formula | C19H18F3NO2S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl 3-benzylsulfanyl-3-(4-methylanilino)-2-(trifluoromethyl)prop-2-enoate |
| SMILES | COC(=O)C(=C(Nc1ccc(C)cc1)SCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO2S/c1-13-8-10-15(11-9-13)23-17(16(18(24)25-2)19(20,21)22)26-12-14-6-4-3-5-7-14/h3-11,23H,12H2,1-2H3 |
| InChIKey | BHFHGEDMDAJEIN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|